C14H22N2O2 — CID 43315071
1-(2,5-dimethoxyphenyl)-N-methylpiperidin-4-amine (PubChem CID 43315071) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-N-methylpiperidin-4-amine.
| Compound Name | 1-(2,5-dimethoxyphenyl)-N-methylpiperidin-4-amine |
|---|---|
| PubChem CID | 43315071 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-N-methylpiperidin-4-amine |
| SMILES | CNC1CCN(c2cc(OC)ccc2OC)CC1 |
| InChI | InChI=1S/C14H22N2O2/c1-15-11-6-8-16(9-7-11)13-10-12(17-2)4-5-14(13)18-3/h4-5,10-11,15H,6-9H2,1-3H3 |
| InChIKey | ACXAJZUOCCMLPF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |