About (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine
(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine (PubChem CID 43316841) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine.
Molecular Properties
| Compound Name | (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine |
| PubChem CID | 43316841 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine |
| SMILES | CC1(C)CCC(CN)c2ccccc21 |
| InChI | InChI=1S/C13H19N/c1-13(2)8-7-10(9-14)11-5-3-4-6-12(11)13/h3-6,10H,7-9,14H2,1-2H3 |
| InChIKey | LBWVCDBPNUUOKM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine?
The IUPAC name of (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine (CID 43316841) is (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine.
What is the SMILES notation for (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine?
The canonical SMILES for (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine is CC1(C)CCC(CN)c2ccccc21.
What is the InChIKey of (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine?
The InChIKey is LBWVCDBPNUUOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N/c1-13(2)8-7-10(9-14)11-5-3-4-6-12(11)13/h3-6,10H,7-9,14H2,1-2H3.
What are the key properties of (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine?
(4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine has a molecular weight of 189.30 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-dimethyl-2,3-dihydro-1H-naphthalen-1-yl)methanamine is sourced from PubChem (CID 43316841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).