C15H24N2O3 — CID 43318992
2-methylpropyl N-(3-aminopropyl)-N-(2-methoxyphenyl)carbamate (PubChem CID 43318992) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-methylpropyl N-(3-aminopropyl)-N-(2-methoxyphenyl)carbamate.
| Compound Name | 2-methylpropyl N-(3-aminopropyl)-N-(2-methoxyphenyl)carbamate |
|---|---|
| PubChem CID | 43318992 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 2-methylpropyl N-(3-aminopropyl)-N-(2-methoxyphenyl)carbamate |
| SMILES | COc1ccccc1N(CCCN)C(=O)OCC(C)C |
| InChI | InChI=1S/C15H24N2O3/c1-12(2)11-20-15(18)17(10-6-9-16)13-7-4-5-8-14(13)19-3/h4-5,7-8,12H,6,9-11,16H2,1-3H3 |
| InChIKey | PTNRETSIFNKHRK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |