C14H22N2O3 — CID 43319202
N-(3-aminopropyl)-N-ethyl-3,4-dimethoxybenzamide (PubChem CID 43319202) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-ethyl-3,4-dimethoxybenzamide.
| Compound Name | N-(3-aminopropyl)-N-ethyl-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 43319202 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(3-aminopropyl)-N-ethyl-3,4-dimethoxybenzamide |
| SMILES | CCN(CCCN)C(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-4-16(9-5-8-15)14(17)11-6-7-12(18-2)13(10-11)19-3/h6-7,10H,4-5,8-9,15H2,1-3H3 |
| InChIKey | XROWQWGYSBJNIF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |