About N'-cyclopentyl-N'-nonylpropane-1,3-diamine
N'-cyclopentyl-N'-nonylpropane-1,3-diamine (PubChem CID 43319594) has the molecular formula C17H36N2
and a molecular weight of 268.49 g/mol. Its IUPAC name is N'-cyclopentyl-N'-nonylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N'-cyclopentyl-N'-nonylpropane-1,3-diamine |
| PubChem CID | 43319594 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | N'-cyclopentyl-N'-nonylpropane-1,3-diamine |
| SMILES | CCCCCCCCCN(CCCN)C1CCCC1 |
| InChI | InChI=1S/C17H36N2/c1-2-3-4-5-6-7-10-15-19(16-11-14-18)17-12-8-9-13-17/h17H,2-16,18H2,1H3 |
| InChIKey | HTZNJGQCEVIIJH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclopentyl-N'-nonylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclopentyl-N'-nonylpropane-1,3-diamine?
The IUPAC name of N'-cyclopentyl-N'-nonylpropane-1,3-diamine (CID 43319594) is N'-cyclopentyl-N'-nonylpropane-1,3-diamine.
What is the SMILES notation for N'-cyclopentyl-N'-nonylpropane-1,3-diamine?
The canonical SMILES for N'-cyclopentyl-N'-nonylpropane-1,3-diamine is CCCCCCCCCN(CCCN)C1CCCC1.
What is the InChIKey of N'-cyclopentyl-N'-nonylpropane-1,3-diamine?
The InChIKey is HTZNJGQCEVIIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36N2/c1-2-3-4-5-6-7-10-15-19(16-11-14-18)17-12-8-9-13-17/h17H,2-16,18H2,1H3.
What are the key properties of N'-cyclopentyl-N'-nonylpropane-1,3-diamine?
N'-cyclopentyl-N'-nonylpropane-1,3-diamine has a molecular weight of 268.49 g/mol, XLogP of 4.33, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclopentyl-N'-nonylpropane-1,3-diamine is sourced from PubChem (CID 43319594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).