C15H17ClN2S — CID 43320468
4-(chloromethyl)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-1,3-thiazole (PubChem CID 43320468) has the molecular formula C15H17ClN2S and a molecular weight of 292.84 g/mol. Its IUPAC name is 4-(chloromethyl)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-1,3-thiazole |
|---|---|
| PubChem CID | 43320468 |
| Molecular Formula | C15H17ClN2S |
| Molecular Weight | 292.84 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 4-(chloromethyl)-2-[2-(3,4-dihydro-2H-quinolin-1-yl)ethyl]-1,3-thiazole |
| SMILES | ClCc1csc(CCN2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C15H17ClN2S/c16-10-13-11-19-15(17-13)7-9-18-8-3-5-12-4-1-2-6-14(12)18/h1-2,4,6,11H,3,5,7-10H2 |
| InChIKey | BXSDJLAKTIWYNT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.84 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|