C11H12ClN3O2S — CID 43320588
1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]pyrimidine-2,4-dione (PubChem CID 43320588) has the molecular formula C11H12ClN3O2S and a molecular weight of 285.76 g/mol. Its IUPAC name is 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]pyrimidine-2,4-dione.
| Compound Name | 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 43320588 |
| Molecular Formula | C11H12ClN3O2S |
| Molecular Weight | 285.76 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 1-[3-[4-(chloromethyl)-1,3-thiazol-2-yl]propyl]pyrimidine-2,4-dione |
| SMILES | O=c1ccn(CCCc2nc(CCl)cs2)c(=O)[nH]1 |
| InChI | InChI=1S/C11H12ClN3O2S/c12-6-8-7-18-10(13-8)2-1-4-15-5-3-9(16)14-11(15)17/h3,5,7H,1-2,4,6H2,(H,14,16,17) |
| InChIKey | QQUWSEPFDKCGAK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.76 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|