C14H11BrFNO2 — CID 43321686
4-[(5-bromo-2-fluorophenyl)methylamino]benzoic acid (PubChem CID 43321686) has the molecular formula C14H11BrFNO2 and a molecular weight of 324.15 g/mol. Its IUPAC name is 4-[(5-bromo-2-fluorophenyl)methylamino]benzoic acid.
| Compound Name | 4-[(5-bromo-2-fluorophenyl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 43321686 |
| Molecular Formula | C14H11BrFNO2 |
| Molecular Weight | 324.15 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 4-[(5-bromo-2-fluorophenyl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccc(NCc2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C14H11BrFNO2/c15-11-3-6-13(16)10(7-11)8-17-12-4-1-9(2-5-12)14(18)19/h1-7,17H,8H2,(H,18,19) |
| InChIKey | TXEWGPNQFNVWKJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |