C18H27NO2 — CID 43322139
2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]benzoic acid (PubChem CID 43322139) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]benzoic acid.
| Compound Name | 2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]benzoic acid |
|---|---|
| PubChem CID | 43322139 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-[[4-(2-methylbutan-2-yl)cyclohexyl]amino]benzoic acid |
| SMILES | CCC(C)(C)C1CCC(Nc2ccccc2C(=O)O)CC1 |
| InChI | InChI=1S/C18H27NO2/c1-4-18(2,3)13-9-11-14(12-10-13)19-16-8-6-5-7-15(16)17(20)21/h5-8,13-14,19H,4,9-12H2,1-3H3,(H,20,21) |
| InChIKey | OVKUCSAKNGGNCK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |