C15H16ClNO2S — CID 43322645
4-(chloromethyl)-2-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole (PubChem CID 43322645) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole.
| Compound Name | 4-(chloromethyl)-2-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 43322645 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 4-(chloromethyl)-2-(5-ethoxy-2-methyl-2,3-dihydro-1-benzofuran-6-yl)-1,3-thiazole |
| SMILES | CCOc1cc2c(cc1-c1nc(CCl)cs1)OC(C)C2 |
| InChI | InChI=1S/C15H16ClNO2S/c1-3-18-14-5-10-4-9(2)19-13(10)6-12(14)15-17-11(7-16)8-20-15/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | RMLASNFDTVMHMT-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|