About 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid
5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (PubChem CID 43323179) has the molecular formula C11H7ClFNO4S2
and a molecular weight of 335.77 g/mol. Its IUPAC name is 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.
Molecular Properties
| Compound Name | 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid |
| PubChem CID | 43323179 |
| Molecular Formula | C11H7ClFNO4S2 |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 334.95 |
| IUPAC Name | 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(S(=O)(=O)Cc2cscn2)c1F |
| InChI | InChI=1S/C11H7ClFNO4S2/c12-6-1-8(11(15)16)10(13)9(2-6)20(17,18)4-7-3-19-5-14-7/h1-3,5H,4H2,(H,15,16) |
| InChIKey | UYCOLORUBAELKC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The IUPAC name of 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (CID 43323179) is 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.
What is the SMILES notation for 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The canonical SMILES for 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid is O=C(O)c1cc(Cl)cc(S(=O)(=O)Cc2cscn2)c1F.
What is the InChIKey of 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The InChIKey is UYCOLORUBAELKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7ClFNO4S2/c12-6-1-8(11(15)16)10(13)9(2-6)20(17,18)4-7-3-19-5-14-7/h1-3,5H,4H2,(H,15,16).
What are the key properties of 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid has a molecular weight of 335.77 g/mol, XLogP of 2.61, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-fluoro-3-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid is sourced from PubChem (CID 43323179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).