C9H5Cl2F3O4S — CID 43323381
2,6-dichloro-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid (PubChem CID 43323381) has the molecular formula C9H5Cl2F3O4S and a molecular weight of 337.10 g/mol. Its IUPAC name is 2,6-dichloro-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid.
| Compound Name | 2,6-dichloro-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43323381 |
| Molecular Formula | C9H5Cl2F3O4S |
| Molecular Weight | 337.10 g/mol |
| Exact Mass | 335.92 |
| IUPAC Name | 2,6-dichloro-3-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1c(Cl)ccc(S(=O)(=O)CC(F)(F)F)c1Cl |
| InChI | InChI=1S/C9H5Cl2F3O4S/c10-4-1-2-5(7(11)6(4)8(15)16)19(17,18)3-9(12,13)14/h1-2H,3H2,(H,15,16) |
| InChIKey | CIQWJETYCUYJFX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.10 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |