2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid

C11H8FNO4S2 — CID 43323575

IUPAC2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid
SMILESO=C(O)c1cc(S(=O)(=O)Cc2cscn2)ccc1F
InChIInChI=1S/C11H8FNO4S2/c12-10-2-1-8(3-9(10)11(14)15)19(16,17)5-7-4-18-6-13-7/h1-4,6H,5H2,(H,14,15)
InChIKeyNRQFQRBAFUSJPN-UHFFFAOYSA-N
MW301.32 g/mol
LogP1.95
Rot. Bonds4

About 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid

2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (PubChem CID 43323575) has the molecular formula C11H8FNO4S2 and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.

Molecular Properties

Compound Name2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid
PubChem CID43323575
Molecular FormulaC11H8FNO4S2
Molecular Weight301.32 g/mol
Exact Mass300.99
IUPAC Name2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid
SMILESO=C(O)c1cc(S(=O)(=O)Cc2cscn2)ccc1F
InChIInChI=1S/C11H8FNO4S2/c12-10-2-1-8(3-9(10)11(14)15)19(16,17)5-7-4-18-6-13-7/h1-4,6H,5H2,(H,14,15)
InChIKeyNRQFQRBAFUSJPN-UHFFFAOYSA-N
XLogP1.95
TPSA84.33 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.32
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The IUPAC name of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (CID 43323575) is 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.
What is the SMILES notation for 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The canonical SMILES for 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid is O=C(O)c1cc(S(=O)(=O)Cc2cscn2)ccc1F.
What is the InChIKey of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The InChIKey is NRQFQRBAFUSJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO4S2/c12-10-2-1-8(3-9(10)11(14)15)19(16,17)5-7-4-18-6-13-7/h1-4,6H,5H2,(H,14,15).
What are the key properties of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid has a molecular weight of 301.32 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid is sourced from PubChem (CID 43323575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).