About 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid
2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (PubChem CID 43323575) has the molecular formula C11H8FNO4S2
and a molecular weight of 301.32 g/mol. Its IUPAC name is 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.
Molecular Properties
| Compound Name | 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid |
| PubChem CID | 43323575 |
| Molecular Formula | C11H8FNO4S2 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Cc2cscn2)ccc1F |
| InChI | InChI=1S/C11H8FNO4S2/c12-10-2-1-8(3-9(10)11(14)15)19(16,17)5-7-4-18-6-13-7/h1-4,6H,5H2,(H,14,15) |
| InChIKey | NRQFQRBAFUSJPN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The IUPAC name of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid (CID 43323575) is 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid.
What is the SMILES notation for 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The canonical SMILES for 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid is O=C(O)c1cc(S(=O)(=O)Cc2cscn2)ccc1F.
What is the InChIKey of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
The InChIKey is NRQFQRBAFUSJPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO4S2/c12-10-2-1-8(3-9(10)11(14)15)19(16,17)5-7-4-18-6-13-7/h1-4,6H,5H2,(H,14,15).
What are the key properties of 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid?
2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid has a molecular weight of 301.32 g/mol, XLogP of 1.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-(1,3-thiazol-4-ylmethylsulfonyl)benzoic acid is sourced from PubChem (CID 43323575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).