About 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid
3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid (PubChem CID 43323721) has the molecular formula C11H8F2N2O5S
and a molecular weight of 318.26 g/mol. Its IUPAC name is 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid.
Molecular Properties
| Compound Name | 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid |
| PubChem CID | 43323721 |
| Molecular Formula | C11H8F2N2O5S |
| Molecular Weight | 318.26 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid |
| SMILES | N#CCNC(=O)CS(=O)(=O)c1ccc(F)c(C(=O)O)c1F |
| InChI | InChI=1S/C11H8F2N2O5S/c12-6-1-2-7(10(13)9(6)11(17)18)21(19,20)5-8(16)15-4-3-14/h1-2H,4-5H2,(H,15,16)(H,17,18) |
| InChIKey | ZELJHLQIUWHPHK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid?
The IUPAC name of 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid (CID 43323721) is 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid.
What is the SMILES notation for 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid?
The canonical SMILES for 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid is N#CCNC(=O)CS(=O)(=O)c1ccc(F)c(C(=O)O)c1F.
What is the InChIKey of 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid?
The InChIKey is ZELJHLQIUWHPHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8F2N2O5S/c12-6-1-2-7(10(13)9(6)11(17)18)21(19,20)5-8(16)15-4-3-14/h1-2H,4-5H2,(H,15,16)(H,17,18).
What are the key properties of 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid?
3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid has a molecular weight of 318.26 g/mol, XLogP of 0.08, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(cyanomethylamino)-2-oxoethyl]sulfonyl-2,6-difluorobenzoic acid is sourced from PubChem (CID 43323721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).