C14H8Cl2N2O2 — CID 43324338
1-(2,4-dichlorophenyl)-3-(furan-2-yl)pyrazole-4-carbaldehyde (PubChem CID 43324338) has the molecular formula C14H8Cl2N2O2 and a molecular weight of 307.14 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-(furan-2-yl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(2,4-dichlorophenyl)-3-(furan-2-yl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 43324338 |
| Molecular Formula | C14H8Cl2N2O2 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-(furan-2-yl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cn(-c2ccc(Cl)cc2Cl)nc1-c1ccco1 |
| InChI | InChI=1S/C14H8Cl2N2O2/c15-10-3-4-12(11(16)6-10)18-7-9(8-19)14(17-18)13-2-1-5-20-13/h1-8H |
| InChIKey | KVAXSWJRNZJIMH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|