C16H17Cl2NO2 — CID 43324923
2-[[4-chloro-2-(chloromethyl)phenoxy]methyl]-4-methoxy-3,5-dimethylpyridine (PubChem CID 43324923) has the molecular formula C16H17Cl2NO2 and a molecular weight of 326.22 g/mol. Its IUPAC name is 2-[[4-chloro-2-(chloromethyl)phenoxy]methyl]-4-methoxy-3,5-dimethylpyridine.
| Compound Name | 2-[[4-chloro-2-(chloromethyl)phenoxy]methyl]-4-methoxy-3,5-dimethylpyridine |
|---|---|
| PubChem CID | 43324923 |
| Molecular Formula | C16H17Cl2NO2 |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-[[4-chloro-2-(chloromethyl)phenoxy]methyl]-4-methoxy-3,5-dimethylpyridine |
| SMILES | COc1c(C)cnc(COc2ccc(Cl)cc2CCl)c1C |
| InChI | InChI=1S/C16H17Cl2NO2/c1-10-8-19-14(11(2)16(10)20-3)9-21-15-5-4-13(18)6-12(15)7-17/h4-6,8H,7,9H2,1-3H3 |
| InChIKey | HQXBXSAGYDFXJP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|