4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid

C12H7Cl2NO3 — CID 43325991

IUPAC4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid
SMILESO=C(O)c1cc(Oc2cc(Cl)ccc2Cl)ccn1
InChIInChI=1S/C12H7Cl2NO3/c13-7-1-2-9(14)11(5-7)18-8-3-4-15-10(6-8)12(16)17/h1-6H,(H,16,17)
InChIKeyAHKWXWZKIGUNIQ-UHFFFAOYSA-N
MW284.10 g/mol
LogP3.88
Rot. Bonds3

About 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid

4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid (PubChem CID 43325991) has the molecular formula C12H7Cl2NO3 and a molecular weight of 284.10 g/mol. Its IUPAC name is 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid.

Molecular Properties

Compound Name4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid
PubChem CID43325991
Molecular FormulaC12H7Cl2NO3
Molecular Weight284.10 g/mol
Exact Mass282.98
IUPAC Name4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid
SMILESO=C(O)c1cc(Oc2cc(Cl)ccc2Cl)ccn1
InChIInChI=1S/C12H7Cl2NO3/c13-7-1-2-9(14)11(5-7)18-8-3-4-15-10(6-8)12(16)17/h1-6H,(H,16,17)
InChIKeyAHKWXWZKIGUNIQ-UHFFFAOYSA-N
XLogP3.88
TPSA59.42 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500284.10
LogP ≤ 53.88
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid?
The IUPAC name of 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid (CID 43325991) is 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid.
What is the SMILES notation for 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid?
The canonical SMILES for 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid is O=C(O)c1cc(Oc2cc(Cl)ccc2Cl)ccn1.
What is the InChIKey of 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid?
The InChIKey is AHKWXWZKIGUNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7Cl2NO3/c13-7-1-2-9(14)11(5-7)18-8-3-4-15-10(6-8)12(16)17/h1-6H,(H,16,17).
What are the key properties of 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid?
4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid has a molecular weight of 284.10 g/mol, XLogP of 3.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dichlorophenoxy)pyridine-2-carboxylic acid is sourced from PubChem (CID 43325991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).