C13H11FN2O2 — CID 43326134
4-(4-fluoro-2-methylanilino)pyridine-2-carboxylic acid (PubChem CID 43326134) has the molecular formula C13H11FN2O2 and a molecular weight of 246.24 g/mol. Its IUPAC name is 4-(4-fluoro-2-methylanilino)pyridine-2-carboxylic acid.
| Compound Name | 4-(4-fluoro-2-methylanilino)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 43326134 |
| Molecular Formula | C13H11FN2O2 |
| Molecular Weight | 246.24 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-(4-fluoro-2-methylanilino)pyridine-2-carboxylic acid |
| SMILES | Cc1cc(F)ccc1Nc1ccnc(C(=O)O)c1 |
| InChI | InChI=1S/C13H11FN2O2/c1-8-6-9(14)2-3-11(8)16-10-4-5-15-12(7-10)13(17)18/h2-7H,1H3,(H,15,16)(H,17,18) |
| InChIKey | IPSIMJUPFHJYQR-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |