C11H8BrCl2N3O2S — CID 43327264
N-(5-amino-2-pyridinyl)-4-bromo-2,6-dichlorobenzenesulfonamide (PubChem CID 43327264) has the molecular formula C11H8BrCl2N3O2S and a molecular weight of 397.08 g/mol. Its IUPAC name is N-(5-amino-2-pyridinyl)-4-bromo-2,6-dichlorobenzenesulfonamide.
| Compound Name | N-(5-amino-2-pyridinyl)-4-bromo-2,6-dichlorobenzenesulfonamide |
|---|---|
| PubChem CID | 43327264 |
| Molecular Formula | C11H8BrCl2N3O2S |
| Molecular Weight | 397.08 g/mol |
| Exact Mass | 394.89 |
| IUPAC Name | N-(5-amino-2-pyridinyl)-4-bromo-2,6-dichlorobenzenesulfonamide |
| SMILES | Nc1ccc(NS(=O)(=O)c2c(Cl)cc(Br)cc2Cl)nc1 |
| InChI | InChI=1S/C11H8BrCl2N3O2S/c12-6-3-8(13)11(9(14)4-6)20(18,19)17-10-2-1-7(15)5-16-10/h1-5H,15H2,(H,16,17) |
| InChIKey | RSHMNBYWHHEDIL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.08 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |