C15H22N2O — CID 43329359
1-(1-aminopentan-3-yl)-4,5-dihydro-3H-1-benzazepin-2-one (PubChem CID 43329359) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-(1-aminopentan-3-yl)-4,5-dihydro-3H-1-benzazepin-2-one.
| Compound Name | 1-(1-aminopentan-3-yl)-4,5-dihydro-3H-1-benzazepin-2-one |
|---|---|
| PubChem CID | 43329359 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-(1-aminopentan-3-yl)-4,5-dihydro-3H-1-benzazepin-2-one |
| SMILES | CCC(CCN)N1C(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C15H22N2O/c1-2-13(10-11-16)17-14-8-4-3-6-12(14)7-5-9-15(17)18/h3-4,6,8,13H,2,5,7,9-11,16H2,1H3 |
| InChIKey | GEWOAOLZYGFYQR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |