C16H14FN3O — CID 43329987
2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-6-methylaniline (PubChem CID 43329987) has the molecular formula C16H14FN3O and a molecular weight of 283.31 g/mol. Its IUPAC name is 2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-6-methylaniline.
| Compound Name | 2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-6-methylaniline |
|---|---|
| PubChem CID | 43329987 |
| Molecular Formula | C16H14FN3O |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[3-[(4-fluorophenyl)methyl]-1,2,4-oxadiazol-5-yl]-6-methylaniline |
| SMILES | Cc1cccc(-c2nc(Cc3ccc(F)cc3)no2)c1N |
| InChI | InChI=1S/C16H14FN3O/c1-10-3-2-4-13(15(10)18)16-19-14(20-21-16)9-11-5-7-12(17)8-6-11/h2-8H,9,18H2,1H3 |
| InChIKey | JAKNJJFMWOSBNA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|