C16H17NO2S — CID 43330711
4-(4-tert-butylphenyl)sulfanylpyridine-2-carboxylic acid (PubChem CID 43330711) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfanylpyridine-2-carboxylic acid.
| Compound Name | 4-(4-tert-butylphenyl)sulfanylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 43330711 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfanylpyridine-2-carboxylic acid |
| SMILES | CC(C)(C)c1ccc(Sc2ccnc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C16H17NO2S/c1-16(2,3)11-4-6-12(7-5-11)20-13-8-9-17-14(10-13)15(18)19/h4-10H,1-3H3,(H,18,19) |
| InChIKey | DYWASWHPANMBGN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |