C11H12N4O2S2 — CID 43331916
4-(1,1-dioxothiolan-3-yl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione (PubChem CID 43331916) has the molecular formula C11H12N4O2S2 and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-(1,1-dioxothiolan-3-yl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(1,1-dioxothiolan-3-yl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 43331916 |
| Molecular Formula | C11H12N4O2S2 |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-(1,1-dioxothiolan-3-yl)-3-pyridin-3-yl-1H-1,2,4-triazole-5-thione |
| SMILES | O=S1(=O)CCC(n2c(-c3cccnc3)n[nH]c2=S)C1 |
| InChI | InChI=1S/C11H12N4O2S2/c16-19(17)5-3-9(7-19)15-10(13-14-11(15)18)8-2-1-4-12-6-8/h1-2,4,6,9H,3,5,7H2,(H,14,18) |
| InChIKey | RYDURTMTILXQQE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|