C13H12Cl2N2O2S — CID 43332038
N-(2,5-dichlorophenyl)-4-(methylamino)benzenesulfonamide (PubChem CID 43332038) has the molecular formula C13H12Cl2N2O2S and a molecular weight of 331.22 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(methylamino)benzenesulfonamide.
| Compound Name | N-(2,5-dichlorophenyl)-4-(methylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 43332038 |
| Molecular Formula | C13H12Cl2N2O2S |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 330.00 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(methylamino)benzenesulfonamide |
| SMILES | CNc1ccc(S(=O)(=O)Nc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C13H12Cl2N2O2S/c1-16-10-3-5-11(6-4-10)20(18,19)17-13-8-9(14)2-7-12(13)15/h2-8,16-17H,1H3 |
| InChIKey | TWAFPMJNBXNBMR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |