C14H14Cl2F2N2 — CID 43333706
3-tert-butyl-5-chloro-4-(chloromethyl)-1-(2,4-difluorophenyl)pyrazole (PubChem CID 43333706) has the molecular formula C14H14Cl2F2N2 and a molecular weight of 319.18 g/mol. Its IUPAC name is 3-tert-butyl-5-chloro-4-(chloromethyl)-1-(2,4-difluorophenyl)pyrazole.
| Compound Name | 3-tert-butyl-5-chloro-4-(chloromethyl)-1-(2,4-difluorophenyl)pyrazole |
|---|---|
| PubChem CID | 43333706 |
| Molecular Formula | C14H14Cl2F2N2 |
| Molecular Weight | 319.18 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 3-tert-butyl-5-chloro-4-(chloromethyl)-1-(2,4-difluorophenyl)pyrazole |
| SMILES | CC(C)(C)c1nn(-c2ccc(F)cc2F)c(Cl)c1CCl |
| InChI | InChI=1S/C14H14Cl2F2N2/c1-14(2,3)12-9(7-15)13(16)20(19-12)11-5-4-8(17)6-10(11)18/h4-6H,7H2,1-3H3 |
| InChIKey | XWIMBEWLFFEXES-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.18 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|