C17H15NO — CID 43333825
3-(2,3-dimethylphenyl)-3-oxo-2-phenylpropanenitrile (PubChem CID 43333825) has the molecular formula C17H15NO and a molecular weight of 249.31 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-3-oxo-2-phenylpropanenitrile.
| Compound Name | 3-(2,3-dimethylphenyl)-3-oxo-2-phenylpropanenitrile |
|---|---|
| PubChem CID | 43333825 |
| Molecular Formula | C17H15NO |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-3-oxo-2-phenylpropanenitrile |
| SMILES | Cc1cccc(C(=O)C(C#N)c2ccccc2)c1C |
| InChI | InChI=1S/C17H15NO/c1-12-7-6-10-15(13(12)2)17(19)16(11-18)14-8-4-3-5-9-14/h3-10,16H,1-2H3 |
| InChIKey | JCFGCPYOJWGAGP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |