C14H15ClFNO — CID 43334022
2-(2-chloro-6-fluorophenyl)-5,5-dimethyl-3-oxohexanenitrile (PubChem CID 43334022) has the molecular formula C14H15ClFNO and a molecular weight of 267.73 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-5,5-dimethyl-3-oxohexanenitrile.
| Compound Name | 2-(2-chloro-6-fluorophenyl)-5,5-dimethyl-3-oxohexanenitrile |
|---|---|
| PubChem CID | 43334022 |
| Molecular Formula | C14H15ClFNO |
| Molecular Weight | 267.73 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-5,5-dimethyl-3-oxohexanenitrile |
| SMILES | CC(C)(C)CC(=O)C(C#N)c1c(F)cccc1Cl |
| InChI | InChI=1S/C14H15ClFNO/c1-14(2,3)7-12(18)9(8-17)13-10(15)5-4-6-11(13)16/h4-6,9H,7H2,1-3H3 |
| InChIKey | DCXAVOGSOWZSBR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |