C16H11Cl2NO2 — CID 43334354
3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)-3-oxopropanenitrile (PubChem CID 43334354) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)-3-oxopropanenitrile.
| Compound Name | 3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 43334354 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-2-(4-methoxyphenyl)-3-oxopropanenitrile |
| SMILES | COc1ccc(C(C#N)C(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl2NO2/c1-21-11-7-5-10(6-8-11)12(9-19)16(20)15-13(17)3-2-4-14(15)18/h2-8,12H,1H3 |
| InChIKey | MPDMTIGWDOURCZ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |