C14H11BrFN3S — CID 43336603
3-(5-bromothiophen-2-yl)-4-(3-fluorophenyl)-1-methylpyrazol-5-amine (PubChem CID 43336603) has the molecular formula C14H11BrFN3S and a molecular weight of 352.23 g/mol. Its IUPAC name is 3-(5-bromothiophen-2-yl)-4-(3-fluorophenyl)-1-methylpyrazol-5-amine.
| Compound Name | 3-(5-bromothiophen-2-yl)-4-(3-fluorophenyl)-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 43336603 |
| Molecular Formula | C14H11BrFN3S |
| Molecular Weight | 352.23 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 3-(5-bromothiophen-2-yl)-4-(3-fluorophenyl)-1-methylpyrazol-5-amine |
| SMILES | Cn1nc(-c2ccc(Br)s2)c(-c2cccc(F)c2)c1N |
| InChI | InChI=1S/C14H11BrFN3S/c1-19-14(17)12(8-3-2-4-9(16)7-8)13(18-19)10-5-6-11(15)20-10/h2-7H,17H2,1H3 |
| InChIKey | WDSGQXVNRILWFO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.23 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |