C15H21N3O — CID 43336628
3-(4-butoxyphenyl)-1,4-dimethylpyrazol-5-amine (PubChem CID 43336628) has the molecular formula C15H21N3O and a molecular weight of 259.35 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-1,4-dimethylpyrazol-5-amine.
| Compound Name | 3-(4-butoxyphenyl)-1,4-dimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 43336628 |
| Molecular Formula | C15H21N3O |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | 3-(4-butoxyphenyl)-1,4-dimethylpyrazol-5-amine |
| SMILES | CCCCOc1ccc(-c2nn(C)c(N)c2C)cc1 |
| InChI | InChI=1S/C15H21N3O/c1-4-5-10-19-13-8-6-12(7-9-13)14-11(2)15(16)18(3)17-14/h6-9H,4-5,10,16H2,1-3H3 |
| InChIKey | VKKCHFUPGUTCCZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|