C13H14ClN3O2S — CID 43336877
3-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine (PubChem CID 43336877) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine.
| Compound Name | 3-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 43336877 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(1,1-dioxothiolan-3-yl)pyrazol-5-amine |
| SMILES | Nc1cc(-c2ccc(Cl)cc2)nn1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H14ClN3O2S/c14-10-3-1-9(2-4-10)12-7-13(15)17(16-12)11-5-6-20(18,19)8-11/h1-4,7,11H,5-6,8,15H2 |
| InChIKey | ZMUFSATWWRPCCV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |