C17H15IO2 — CID 43339712
2,3-dihydro-1H-inden-5-yl-(5-iodo-2-methoxyphenyl)methanone (PubChem CID 43339712) has the molecular formula C17H15IO2 and a molecular weight of 378.21 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl-(5-iodo-2-methoxyphenyl)methanone.
| Compound Name | 2,3-dihydro-1H-inden-5-yl-(5-iodo-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 43339712 |
| Molecular Formula | C17H15IO2 |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl-(5-iodo-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(I)cc1C(=O)c1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C17H15IO2/c1-20-16-8-7-14(18)10-15(16)17(19)13-6-5-11-3-2-4-12(11)9-13/h5-10H,2-4H2,1H3 |
| InChIKey | CYWFHPPGYSTGLH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|