C12H16F3NO3S — CID 43342588
3-butan-2-yl-4-(2,2,2-trifluoroethoxy)benzenesulfonamide (PubChem CID 43342588) has the molecular formula C12H16F3NO3S and a molecular weight of 311.33 g/mol. Its IUPAC name is 3-butan-2-yl-4-(2,2,2-trifluoroethoxy)benzenesulfonamide.
| Compound Name | 3-butan-2-yl-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 43342588 |
| Molecular Formula | C12H16F3NO3S |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 3-butan-2-yl-4-(2,2,2-trifluoroethoxy)benzenesulfonamide |
| SMILES | CCC(C)c1cc(S(N)(=O)=O)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C12H16F3NO3S/c1-3-8(2)10-6-9(20(16,17)18)4-5-11(10)19-7-12(13,14)15/h4-6,8H,3,7H2,1-2H3,(H2,16,17,18) |
| InChIKey | DGJADJWJQFTPGU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |