About N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine
N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine (PubChem CID 43344) has the molecular formula C11H15N5
and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-tert-butyl-1-cyano-3-pyridin-3-ylguanidine.
Molecular Properties
| Compound Name | N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine |
| PubChem CID | 43344 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-tert-butyl-1-cyano-3-pyridin-3-ylguanidine |
| SMILES | CC(C)(C)N=C(NC#N)NC1=CN=CC=C1 |
| InChI | InChI=1S/C11H15N5/c1-11(2,3)16-10(14-8-12)15-9-5-4-6-13-7-9/h4-7H,1-3H3,(H2,14,15,16) |
| InChIKey | TXXOFXVEUPZZHB-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 293 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine?
The IUPAC name of N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine (CID 43344) is 2-tert-butyl-1-cyano-3-pyridin-3-ylguanidine.
What is the SMILES notation for N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine?
The canonical SMILES for N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine is CC(C)(C)N=C(NC#N)NC1=CN=CC=C1.
What is the InChIKey of N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine?
The InChIKey is TXXOFXVEUPZZHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5/c1-11(2,3)16-10(14-8-12)15-9-5-4-6-13-7-9/h4-7H,1-3H3,(H2,14,15,16).
What are the key properties of N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine?
N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine has a molecular weight of 217.27 g/mol, XLogP of 1.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-Cyano-N'-(1,1-dimethylethyl)-N''-3-pyridinylguanidine is sourced from PubChem (CID 43344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).