About cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine
cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine (PubChem CID 43344797) has the molecular formula C11H15Cl2NS
and a molecular weight of 264.22 g/mol. Its IUPAC name is cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine.
Molecular Properties
| Compound Name | cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine |
| PubChem CID | 43344797 |
| Molecular Formula | C11H15Cl2NS |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine |
| SMILES | NC(c1cc(Cl)sc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C11H15Cl2NS/c12-9-6-8(11(13)15-9)10(14)7-4-2-1-3-5-7/h6-7,10H,1-5,14H2 |
| InChIKey | FOHVUKMCLPTFLD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine?
The IUPAC name of cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine (CID 43344797) is cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine.
What is the SMILES notation for cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine?
The canonical SMILES for cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine is NC(c1cc(Cl)sc1Cl)C1CCCCC1.
What is the InChIKey of cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine?
The InChIKey is FOHVUKMCLPTFLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15Cl2NS/c12-9-6-8(11(13)15-9)10(14)7-4-2-1-3-5-7/h6-7,10H,1-5,14H2.
What are the key properties of cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine?
cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine has a molecular weight of 264.22 g/mol, XLogP of 4.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(2,5-dichlorothiophen-3-yl)methanamine is sourced from PubChem (CID 43344797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).