C12H11Br2NS — CID 43345006
(2,5-dibromothiophen-3-yl)-(3-methylphenyl)methanamine (PubChem CID 43345006) has the molecular formula C12H11Br2NS and a molecular weight of 361.10 g/mol. Its IUPAC name is (2,5-dibromothiophen-3-yl)-(3-methylphenyl)methanamine.
| Compound Name | (2,5-dibromothiophen-3-yl)-(3-methylphenyl)methanamine |
|---|---|
| PubChem CID | 43345006 |
| Molecular Formula | C12H11Br2NS |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 358.90 |
| IUPAC Name | (2,5-dibromothiophen-3-yl)-(3-methylphenyl)methanamine |
| SMILES | Cc1cccc(C(N)c2cc(Br)sc2Br)c1 |
| InChI | InChI=1S/C12H11Br2NS/c1-7-3-2-4-8(5-7)11(15)9-6-10(13)16-12(9)14/h2-6,11H,15H2,1H3 |
| InChIKey | LTBWCVGKHRZPLS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |