About 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one
7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one (PubChem CID 43345501) has the molecular formula C10H8F2OS
and a molecular weight of 214.24 g/mol. Its IUPAC name is 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one.
Molecular Properties
| Compound Name | 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one |
| PubChem CID | 43345501 |
| Molecular Formula | C10H8F2OS |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one |
| SMILES | O=C1CCCSc2c(F)cc(F)cc21 |
| InChI | InChI=1S/C10H8F2OS/c11-6-4-7-9(13)2-1-3-14-10(7)8(12)5-6/h4-5H,1-3H2 |
| InChIKey | LYRNWJRHIYHPKR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one?
The IUPAC name of 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one (CID 43345501) is 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one.
What is the SMILES notation for 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one?
The canonical SMILES for 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one is O=C1CCCSc2c(F)cc(F)cc21.
What is the InChIKey of 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one?
The InChIKey is LYRNWJRHIYHPKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F2OS/c11-6-4-7-9(13)2-1-3-14-10(7)8(12)5-6/h4-5H,1-3H2.
What are the key properties of 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one?
7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one has a molecular weight of 214.24 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,9-difluoro-3,4-dihydro-2H-1-benzothiepin-5-one is sourced from PubChem (CID 43345501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).