C8H11N3O2 — CID 43346089
3-(2-oxo-1-pyridinyl)propanehydrazide (PubChem CID 43346089) has the molecular formula C8H11N3O2 and a molecular weight of 181.20 g/mol. Its IUPAC name is 3-(2-oxo-1-pyridinyl)propanehydrazide.
| Compound Name | 3-(2-oxo-1-pyridinyl)propanehydrazide |
|---|---|
| PubChem CID | 43346089 |
| Molecular Formula | C8H11N3O2 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-(2-oxo-1-pyridinyl)propanehydrazide |
| SMILES | NNC(=O)CCn1ccccc1=O |
| InChI | InChI=1S/C8H11N3O2/c9-10-7(12)4-6-11-5-2-1-3-8(11)13/h1-3,5H,4,6,9H2,(H,10,12) |
| InChIKey | NZIVFPHKFQUFSK-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|