About 2-bromo-N-ethyl-4,6-difluoroaniline
2-bromo-N-ethyl-4,6-difluoroaniline (PubChem CID 43347584) has the molecular formula C8H8BrF2N
and a molecular weight of 236.06 g/mol. Its IUPAC name is 2-bromo-N-ethyl-4,6-difluoroaniline.
Molecular Properties
| Compound Name | 2-bromo-N-ethyl-4,6-difluoroaniline |
| PubChem CID | 43347584 |
| Molecular Formula | C8H8BrF2N |
| Molecular Weight | 236.06 g/mol |
| Exact Mass | 234.98 |
| IUPAC Name | 2-bromo-N-ethyl-4,6-difluoroaniline |
| SMILES | CCNc1c(F)cc(F)cc1Br |
| InChI | InChI=1S/C8H8BrF2N/c1-2-12-8-6(9)3-5(10)4-7(8)11/h3-4,12H,2H2,1H3 |
| InChIKey | FFMGMDXOUWNWDY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.06 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-N-ethyl-4,6-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-ethyl-4,6-difluoroaniline?
The IUPAC name of 2-bromo-N-ethyl-4,6-difluoroaniline (CID 43347584) is 2-bromo-N-ethyl-4,6-difluoroaniline.
What is the SMILES notation for 2-bromo-N-ethyl-4,6-difluoroaniline?
The canonical SMILES for 2-bromo-N-ethyl-4,6-difluoroaniline is CCNc1c(F)cc(F)cc1Br.
What is the InChIKey of 2-bromo-N-ethyl-4,6-difluoroaniline?
The InChIKey is FFMGMDXOUWNWDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrF2N/c1-2-12-8-6(9)3-5(10)4-7(8)11/h3-4,12H,2H2,1H3.
What are the key properties of 2-bromo-N-ethyl-4,6-difluoroaniline?
2-bromo-N-ethyl-4,6-difluoroaniline has a molecular weight of 236.06 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-ethyl-4,6-difluoroaniline is sourced from PubChem (CID 43347584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).