C9H17N3O2 — CID 43348493
N-(3-hydrazinyl-3-oxopropyl)cyclopentanecarboxamide (PubChem CID 43348493) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is N-(3-hydrazinyl-3-oxopropyl)cyclopentanecarboxamide.
| Compound Name | N-(3-hydrazinyl-3-oxopropyl)cyclopentanecarboxamide |
|---|---|
| PubChem CID | 43348493 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-(3-hydrazinyl-3-oxopropyl)cyclopentanecarboxamide |
| SMILES | NNC(=O)CCNC(=O)C1CCCC1 |
| InChI | InChI=1S/C9H17N3O2/c10-12-8(13)5-6-11-9(14)7-3-1-2-4-7/h7H,1-6,10H2,(H,11,14)(H,12,13) |
| InChIKey | CHMZSMFHHRJHQT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|