C13H26N4O2 — CID 43348706
N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-piperazin-1-ylacetamide (PubChem CID 43348706) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-piperazin-1-ylacetamide.
| Compound Name | N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 43348706 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-ethyl-N-[2-oxo-2-(propan-2-ylamino)ethyl]-2-piperazin-1-ylacetamide |
| SMILES | CCN(CC(=O)NC(C)C)C(=O)CN1CCNCC1 |
| InChI | InChI=1S/C13H26N4O2/c1-4-17(9-12(18)15-11(2)3)13(19)10-16-7-5-14-6-8-16/h11,14H,4-10H2,1-3H3,(H,15,18) |
| InChIKey | RMVHLOVCFAKGMQ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |