C17H18BrNO — CID 43349787
3-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline (PubChem CID 43349787) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 3-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline.
| Compound Name | 3-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline |
|---|---|
| PubChem CID | 43349787 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 3-bromo-2-(1,2,3,4-tetrahydronaphthalen-1-yloxymethyl)aniline |
| SMILES | Nc1cccc(Br)c1COC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H18BrNO/c18-15-8-4-9-16(19)14(15)11-20-17-10-3-6-12-5-1-2-7-13(12)17/h1-2,4-5,7-9,17H,3,6,10-11,19H2 |
| InChIKey | OMXSESITCFJBBT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|