C13H10BrCl2NS — CID 43349828
3-bromo-2-[(2,5-dichlorophenyl)sulfanylmethyl]aniline (PubChem CID 43349828) has the molecular formula C13H10BrCl2NS and a molecular weight of 363.11 g/mol. Its IUPAC name is 3-bromo-2-[(2,5-dichlorophenyl)sulfanylmethyl]aniline.
| Compound Name | 3-bromo-2-[(2,5-dichlorophenyl)sulfanylmethyl]aniline |
|---|---|
| PubChem CID | 43349828 |
| Molecular Formula | C13H10BrCl2NS |
| Molecular Weight | 363.11 g/mol |
| Exact Mass | 360.91 |
| IUPAC Name | 3-bromo-2-[(2,5-dichlorophenyl)sulfanylmethyl]aniline |
| SMILES | Nc1cccc(Br)c1CSc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H10BrCl2NS/c14-10-2-1-3-12(17)9(10)7-18-13-6-8(15)4-5-11(13)16/h1-6H,7,17H2 |
| InChIKey | XDFOVFLKRXHFPZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.11 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|