C10H9ClN2O4 — CID 43350343
3-[(4-chloro-3-nitrophenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 43350343) has the molecular formula C10H9ClN2O4 and a molecular weight of 256.64 g/mol. Its IUPAC name is 3-[(4-chloro-3-nitrophenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(4-chloro-3-nitrophenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 43350343 |
| Molecular Formula | C10H9ClN2O4 |
| Molecular Weight | 256.64 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | 3-[(4-chloro-3-nitrophenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1Cc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9ClN2O4/c11-8-2-1-7(5-9(8)13(15)16)6-12-3-4-17-10(12)14/h1-2,5H,3-4,6H2 |
| InChIKey | YIIJVRLYSJKZRE-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|