About 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene
1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene (PubChem CID 43350570) has the molecular formula C13H8ClF2NO2S
and a molecular weight of 315.73 g/mol. Its IUPAC name is 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene.
Molecular Properties
| Compound Name | 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene |
| PubChem CID | 43350570 |
| Molecular Formula | C13H8ClF2NO2S |
| Molecular Weight | 315.73 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(Cl)c(CSc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C13H8ClF2NO2S/c14-11-3-1-9(17(18)19)5-8(11)7-20-10-2-4-12(15)13(16)6-10/h1-6H,7H2 |
| InChIKey | LVFCQIACBJDGLX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.73 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene?
The IUPAC name of 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene (CID 43350570) is 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene.
What is the SMILES notation for 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene?
The canonical SMILES for 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene is O=[N+]([O-])c1ccc(Cl)c(CSc2ccc(F)c(F)c2)c1.
What is the InChIKey of 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene?
The InChIKey is LVFCQIACBJDGLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8ClF2NO2S/c14-11-3-1-9(17(18)19)5-8(11)7-20-10-2-4-12(15)13(16)6-10/h1-6H,7H2.
What are the key properties of 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene?
1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene has a molecular weight of 315.73 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-[(3,4-difluorophenyl)sulfanylmethyl]-4-nitrobenzene is sourced from PubChem (CID 43350570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).