C12H17N3O5S — CID 43350628
4-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid (PubChem CID 43350628) has the molecular formula C12H17N3O5S and a molecular weight of 315.35 g/mol. Its IUPAC name is 4-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 4-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43350628 |
| Molecular Formula | C12H17N3O5S |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 4-[1-(2-methoxyethylamino)-1-oxopropan-2-yl]sulfanyl-6-methyl-2-oxo-1H-pyrimidine-5-carboxylic acid |
| SMILES | COCCNC(=O)C(C)Sc1nc(=O)[nH]c(C)c1C(=O)O |
| InChI | InChI=1S/C12H17N3O5S/c1-6-8(11(17)18)10(15-12(19)14-6)21-7(2)9(16)13-4-5-20-3/h7H,4-5H2,1-3H3,(H,13,16)(H,17,18)(H,14,15,19) |
| InChIKey | GEBAFCBYBROWKY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|