C11H15N3O4S — CID 43350663
6-methyl-2-oxo-4-[2-oxo-2-(propylamino)ethyl]sulfanyl-1H-pyrimidine-5-carboxylic acid (PubChem CID 43350663) has the molecular formula C11H15N3O4S and a molecular weight of 285.32 g/mol. Its IUPAC name is 6-methyl-2-oxo-4-[2-oxo-2-(propylamino)ethyl]sulfanyl-1H-pyrimidine-5-carboxylic acid.
| Compound Name | 6-methyl-2-oxo-4-[2-oxo-2-(propylamino)ethyl]sulfanyl-1H-pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 43350663 |
| Molecular Formula | C11H15N3O4S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 6-methyl-2-oxo-4-[2-oxo-2-(propylamino)ethyl]sulfanyl-1H-pyrimidine-5-carboxylic acid |
| SMILES | CCCNC(=O)CSc1nc(=O)[nH]c(C)c1C(=O)O |
| InChI | InChI=1S/C11H15N3O4S/c1-3-4-12-7(15)5-19-9-8(10(16)17)6(2)13-11(18)14-9/h3-5H2,1-2H3,(H,12,15)(H,16,17)(H,13,14,18) |
| InChIKey | FCZPPNMGZULSOT-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |