C14H18ClN3O3 — CID 43351015
1-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid (PubChem CID 43351015) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 1-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43351015 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-[[(E)-3-(5-chloro-1,3-dimethylpyrazol-4-yl)prop-2-enoyl]amino]cyclopentane-1-carboxylic acid |
| SMILES | Cc1nn(C)c(Cl)c1/C=C/C(=O)NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C14H18ClN3O3/c1-9-10(12(15)18(2)17-9)5-6-11(19)16-14(13(20)21)7-3-4-8-14/h5-6H,3-4,7-8H2,1-2H3,(H,16,19)(H,20,21)/b6-5+ |
| InChIKey | JJLTUYKGXCOJEQ-AATRIKPKSA-N |
| XLogP | 1.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|