C12H19NO5 — CID 43351037
1-[(4-ethoxy-4-oxobutanoyl)amino]cyclopentane-1-carboxylic acid (PubChem CID 43351037) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 1-[(4-ethoxy-4-oxobutanoyl)amino]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[(4-ethoxy-4-oxobutanoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 43351037 |
| Molecular Formula | C12H19NO5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1-[(4-ethoxy-4-oxobutanoyl)amino]cyclopentane-1-carboxylic acid |
| SMILES | CCOC(=O)CCC(=O)NC1(C(=O)O)CCCC1 |
| InChI | InChI=1S/C12H19NO5/c1-2-18-10(15)6-5-9(14)13-12(11(16)17)7-3-4-8-12/h2-8H2,1H3,(H,13,14)(H,16,17) |
| InChIKey | REMQRIVWDFKPHD-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |