C13H13N3O4 — CID 43351280
3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]benzoic acid (PubChem CID 43351280) has the molecular formula C13H13N3O4 and a molecular weight of 275.26 g/mol. Its IUPAC name is 3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]benzoic acid.
| Compound Name | 3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]benzoic acid |
|---|---|
| PubChem CID | 43351280 |
| Molecular Formula | C13H13N3O4 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-[3-(3-methyl-1,2,4-oxadiazol-5-yl)propanoylamino]benzoic acid |
| SMILES | Cc1noc(CCC(=O)Nc2cccc(C(=O)O)c2)n1 |
| InChI | InChI=1S/C13H13N3O4/c1-8-14-12(20-16-8)6-5-11(17)15-10-4-2-3-9(7-10)13(18)19/h2-4,7H,5-6H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | OZYBUSVUAWLXOY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |